cas: 365998-35-2 — see every product listed under this CAS number, including other names
Benzyl tert-butyl ((1S,2R,4S)-4-(dimethylcarbamoyl)cyclohexane-1,2-diyl)dicarbamate, 95+% (CAS 365998-35-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A594519-10g |
| cas | 365998-35-2 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 4985.05 Pln | |
| AmBeed | 25g | 6020.14 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
Benzyl N-[(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]carbamate (CAS 365998-35-2) is a chemical compound with the molecular formula C22H33N3O5 and a molecular weight of 419.5 g/mol. IUPAC name: benzyl N-[(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]carbamate. InChIKey: BHLRESHKGHNBEV-OKZBNKHCSA-N.
| Molecular formula | C22H33N3O5 |
|---|---|
| Molecular weight | 419.5 g/mol |
| IUPAC name | benzyl N-[(1S,2R,4S)-4-(dimethylcarbamoyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexyl]carbamate |
| InChIKey | BHLRESHKGHNBEV-OKZBNKHCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C[C@H](CC[C@@H]1NC(=O)OCC2=CC=CC=C2)C(=O)N(C)C |
Computed by PubChem (NCBI)