CAS 61864-82-2 appears in our catalog under these names: For-Nle-Leu-Phe-OH, For–Nle–Leu–Phe–OH. Offered by: Creative Peptides, GLPBio, Biosynth. Available pack sizes: on request, 250mg, 500mg, 0,1g, 0,05g, 0,25g, 0,5g, 1g.
(2S)-2-[[(2S)-2-[[(2S)-2-formamidohexanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid (CAS 61864-82-2) is a chemical compound with the molecular formula C22H33N3O5 and a molecular weight of 419.5 g/mol. IUPAC name: (2S)-2-[[(2S)-2-[[(2S)-2-formamidohexanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid. InChIKey: ZNPUQLFXFVLCID-FHWLQOOXSA-N.
| Molecular formula | C22H33N3O5 |
|---|---|
| Molecular weight | 419.5 g/mol |
| IUPAC name | (2S)-2-[[(2S)-2-[[(2S)-2-formamidohexanoyl]amino]-4-methylpentanoyl]amino]-3-phenylpropanoic acid |
| InChIKey | ZNPUQLFXFVLCID-FHWLQOOXSA-N |
| SMILES | CCCC[C@@H](C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](CC1=CC=CC=C1)C(=O)O)NC=O |
Computed by PubChem (NCBI)