CAS 959-55-7 appears in our catalog under these names: Benzyldimethyloctylammonium Chloride, Benzyldimethyloctylammonium chloride 100 µg/mL in Acetonitrile, Benzyldimethyloctylammonium chloride, 95%, 95%, Benzyldimethyloctylammonium chloride, Concentration: 100 µg/ml Solvent: Acetonitrile, Benzenemethanaminium, N,N-dimethyl-N-octyl-, chloride, ≥95%. Offered by: Chemat Brand, Dr. Ehrenstorfer, Sigma-Aldrich, Chemat, HPC Standards. Available pack sizes: on request, 100mg, 1ml, 25G, 5G, 250mg, 1g, 1x10ml.
Benzyl-dimethyl-octylazanium chloride (CAS 959-55-7) is a chemical compound with the molecular formula C17H30ClN and a molecular weight of 283.9 g/mol. IUPAC name: benzyl-dimethyl-octylazanium chloride. InChIKey: PXFDQFDPXWHEEP-UHFFFAOYSA-M.
| Molecular formula | C17H30ClN |
|---|---|
| Molecular weight | 283.9 g/mol |
| IUPAC name | benzyl-dimethyl-octylazanium chloride |
| InChIKey | PXFDQFDPXWHEEP-UHFFFAOYSA-M |
| SMILES | CCCCCCCC[N+](C)(C)CC1=CC=CC=C1.[Cl-] |
Computed by PubChem (NCBI)