cas: 405165-61-9 — see every product listed under this CAS number, including other names
Besifloxacin HCl 99% (CAS 405165-61-9) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A263240-1mg |
| cas | 405165-61-9 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 175.69 Pln | |
| Ambeed | 10mg | 253.56 Pln | |
| Ambeed | 100mg | 581.75 Pln | |
| Ambeed | 250mg | 932.19 Pln | |
| Ambeed | 1g | 2384.00 Pln | |
| Ambeed | 5g | 8174.56 Pln |
| purity | 99% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A263240 |
7-[(3R)-3-aminoazepan-1-yl]-8-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid;hydrochloride (CAS 405165-61-9) is a chemical compound with the molecular formula C19H22Cl2FN3O3 and a molecular weight of 430.3 g/mol. IUPAC name: 7-[(3R)-3-aminoazepan-1-yl]-8-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid;hydrochloride. InChIKey: PMQBICKXAAKXAY-HNCPQSOCSA-N.
| Molecular formula | C19H22Cl2FN3O3 |
|---|---|
| Molecular weight | 430.3 g/mol |
| IUPAC name | 7-[(3R)-3-aminoazepan-1-yl]-8-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid;hydrochloride |
| InChIKey | PMQBICKXAAKXAY-HNCPQSOCSA-N |
| SMILES | C1CCN(C[C@@H](C1)N)C2=C(C=C3C(=C2Cl)N(C=C(C3=O)C(=O)O)C4CC4)F.Cl |
Computed by PubChem (NCBI)