CAS 1398566-42-1 appears in our catalog under these names: Besifloxacin Impurity A HCl, S-Besifloxacin Hydrochloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 10mg.
7-[(3S)-3-aminoazepan-1-yl]-8-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid;hydrochloride (CAS 1398566-42-1) is a chemical compound with the molecular formula C19H22Cl2FN3O3 and a molecular weight of 430.3 g/mol. IUPAC name: 7-[(3S)-3-aminoazepan-1-yl]-8-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid;hydrochloride. InChIKey: PMQBICKXAAKXAY-PPHPATTJSA-N.
| Molecular formula | C19H22Cl2FN3O3 |
|---|---|
| Molecular weight | 430.3 g/mol |
| IUPAC name | 7-[(3S)-3-aminoazepan-1-yl]-8-chloro-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid;hydrochloride |
| InChIKey | PMQBICKXAAKXAY-PPHPATTJSA-N |
| SMILES | C1CCN(C[C@H](C1)N)C2=C(C=C3C(=C2Cl)N(C=C(C3=O)C(=O)O)C4CC4)F.Cl |
Computed by PubChem (NCBI)