Products 2376257-44-0
CAS 2376257-44-0 appears in our catalog under these names: Bexotegrast/ 99.53% (existing batch purity), Bexotegrast, Bexotegrast 96%, BEXOTEGRAST (PLN-74809), 96%, 96%, Bexotegrast, 99.74%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 100 mg.
(2S)-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid (CAS 2376257-44-0) is a chemical compound with the molecular formula C27H36N6O3 and a molecular weight of 492.6 g/mol. IUPAC name: (2S)-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid. InChIKey: CWOFQJBATWQSHL-DEOSSOPVSA-N.
| Molecular formula | C27H36N6O3 |
|---|---|
| Molecular weight | 492.6 g/mol |
| IUPAC name | (2S)-4-[2-methoxyethyl-[4-(5,6,7,8-tetrahydro-1,8-naphthyridin-2-yl)butyl]amino]-2-(quinazolin-4-ylamino)butanoic acid |
| InChIKey | CWOFQJBATWQSHL-DEOSSOPVSA-N |
| SMILES | COCCN(CCCCC1=NC2=C(CCCN2)C=C1)CC[C@@H](C(=O)O)NC3=NC=NC4=CC=CC=C43 |
Computed by PubChem (NCBI)