CAS 144348-08-3 appears in our catalog under these names: Binodenoson/ 99.84% (existing batch purity), Binodenoson, Binodenoson 99%, Binodenoson, 95%, 95%, Binodenoson, 98.01%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 100 mg.
(2R,3R,4S,5R)-2-[6-amino-2-[(2E)-2-(cyclohexylmethylidene)hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol (CAS 144348-08-3) is a chemical compound with the molecular formula C17H25N7O4 and a molecular weight of 391.4 g/mol. IUPAC name: (2R,3R,4S,5R)-2-[6-amino-2-[(2E)-2-(cyclohexylmethylidene)hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol. InChIKey: XJFMHMFFBSOEPR-DNZQAUTHSA-N.
| Molecular formula | C17H25N7O4 |
|---|---|
| Molecular weight | 391.4 g/mol |
| IUPAC name | (2R,3R,4S,5R)-2-[6-amino-2-[(2E)-2-(cyclohexylmethylidene)hydrazinyl]purin-9-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| InChIKey | XJFMHMFFBSOEPR-DNZQAUTHSA-N |
| SMILES | C1CCC(CC1)/C=N/NC2=NC(=C3C(=N2)N(C=N3)[C@H]4[C@@H]([C@@H]([C@H](O4)CO)O)O)N |
Computed by PubChem (NCBI)