Biotin-PEG2-Acid, 97%
cas: 1365655-89-5 — see every product listed under this CAS number, including other names
Biotin-PEG2-Acid, 97% (CAS 1365655-89-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 500mg. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch11233Z-50mg |
| cas | 1365655-89-5 |
| size | 50mg |
| availability | 2g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 390.80 Pln | |
| Chemat | 100mg | 698.00 Pln | |
| Chemat | 250mg | 1173.20 Pln | |
| Chemat | 1g | 2958.80 Pln | |
| Fluorochem | 100mg | 643.54 Pln | |
| Fluorochem | 250mg | 883.04 Pln | |
| Fluorochem | 500mg | 1455.76 Pln | |
| Fluorochem | 1g | 1841.04 Pln | |
| Fluorochem | 50mg | 372.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]propanoic acid (CAS 1365655-89-5) is a chemical compound with the molecular formula C17H29N3O6S and a molecular weight of 403.5 g/mol. IUPAC name: 3-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]propanoic acid. InChIKey: SDOAIZRTYJIBBG-XEZPLFJOSA-N.
| Molecular formula | C17H29N3O6S |
|---|---|
| Molecular weight | 403.5 g/mol |
| IUPAC name | 3-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]propanoic acid |
| InChIKey | SDOAIZRTYJIBBG-XEZPLFJOSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NCCOCCOCCC(=O)O)NC(=O)N2 |
Computed by PubChem (NCBI)