cas: 1786206-22-1 — see every product listed under this CAS number, including other names
Biotin-PEG3-oxyamine HCl salt, 98%, 98% (CAS 1786206-22-1) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 50mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120DZY-25mg |
| cas | 1786206-22-1 |
| size | 25mg |
| availability | 0.3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 990.80 Pln | |
| Chemat | 100mg | 2637.20 Pln | |
| Chemat | 50mg | 1509.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
N-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (CAS 1786206-22-1) is a chemical compound with the molecular formula C18H34N4O6S and a molecular weight of 434.6 g/mol. IUPAC name: N-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide. InChIKey: OLCOSDGJNTXSBD-UHFFFAOYSA-N.
| Molecular formula | C18H34N4O6S |
|---|---|
| Molecular weight | 434.6 g/mol |
| IUPAC name | N-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| InChIKey | OLCOSDGJNTXSBD-UHFFFAOYSA-N |
| SMILES | C1C2C(C(S1)CCCCC(=O)NCCOCCOCCOCCON)NC(=O)N2 |
Computed by PubChem (NCBI)