cas: 1786206-22-1 — see every product listed under this CAS number, including other names
Biotin-PEG3-oxyamine, 98% (CAS 1786206-22-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1251021-100mg |
| cas | 1786206-22-1 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 4132.24 Pln | |
| AmBeed | 1g | 23766.40 Pln | |
| AmBeed | 250mg | 7517.44 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
N-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (CAS 1786206-22-1) is a chemical compound with the molecular formula C18H34N4O6S and a molecular weight of 434.6 g/mol. IUPAC name: N-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide. InChIKey: OLCOSDGJNTXSBD-UHFFFAOYSA-N.
| Molecular formula | C18H34N4O6S |
|---|---|
| Molecular weight | 434.6 g/mol |
| IUPAC name | N-[2-[2-[2-(2-aminooxyethoxy)ethoxy]ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| InChIKey | OLCOSDGJNTXSBD-UHFFFAOYSA-N |
| SMILES | C1C2C(C(S1)CCCCC(=O)NCCOCCOCCOCCON)NC(=O)N2 |
Computed by PubChem (NCBI)