Biotin-PEG8-NHS ester 95%
cas: 2143968-03-8 — see every product listed under this CAS number, including other names
Biotin-PEG8-NHS ester 95% (CAS 2143968-03-8) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A754653-50mg |
| cas | 2143968-03-8 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 932.19 Pln | |
| Ambeed | 100mg | 1199.19 Pln | |
| Ambeed | 250mg | 2395.12 Pln | |
| Ambeed | 1g | 4748.06 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A754653 |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 2143968-03-8) is a chemical compound with the molecular formula C33H56N4O14S and a molecular weight of 764.9 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: YCGZDGOCJORRHA-IUEKTVKYSA-N.
| Molecular formula | C33H56N4O14S |
|---|---|
| Molecular weight | 764.9 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | YCGZDGOCJORRHA-IUEKTVKYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCCC[C@H]2[C@@H]3[C@H](CS2)NC(=O)N3 |
Computed by PubChem (NCBI)