cas: 2143968-03-8 — see every product listed under this CAS number, including other names
Biotin-PEG8-NHS, 95%, 95% (CAS 2143968-03-8) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12FVIP-25mg |
| cas | 2143968-03-8 |
| size | 25mg |
| availability | 0.5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 390.80 Pln | |
| Chemat | 50mg | 654.80 Pln | |
| Chemat | 100mg | 890.00 Pln | |
| Chemat | 250mg | 1619.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 2143968-03-8) is a chemical compound with the molecular formula C33H56N4O14S and a molecular weight of 764.9 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: YCGZDGOCJORRHA-IUEKTVKYSA-N.
| Molecular formula | C33H56N4O14S |
|---|---|
| Molecular weight | 764.9 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | YCGZDGOCJORRHA-IUEKTVKYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)CCCC[C@H]2[C@@H]3[C@H](CS2)NC(=O)N3 |
Computed by PubChem (NCBI)