Biotin-sar-oh, 98%, 98%
cas: 154024-76-7 — see every product listed under this CAS number, including other names
Biotin-sar-oh, 98%, 98% (CAS 154024-76-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HY86-250mg |
| cas | 154024-76-7 |
| size | 250mg |
| availability | 1g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 414.80 Pln | |
| Chemat | 100mg | 275.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl-methylamino]acetic acid (CAS 154024-76-7) is a chemical compound with the molecular formula C13H21N3O4S and a molecular weight of 315.39 g/mol. IUPAC name: 2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl-methylamino]acetic acid. InChIKey: FCDUPOLHSWBTFL-AUTRQRHGSA-N.
| Molecular formula | C13H21N3O4S |
|---|---|
| Molecular weight | 315.39 g/mol |
| IUPAC name | 2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl-methylamino]acetic acid |
| InChIKey | FCDUPOLHSWBTFL-AUTRQRHGSA-N |
| SMILES | CN(CC(=O)O)C(=O)CCCC[C@H]1[C@@H]2[C@H](CS1)NC(=O)N2 |
Computed by PubChem (NCBI)