Products 154024-76-7
CAS 154024-76-7 appears in our catalog under these names: Biotin-Sar-OH, 97%, Biotin–sar–oh, (+)-Biotin-sarcosine, Biotinoylsarcosine, Biotin-sar-oh, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Roth. Available pack sizes: 1g, 25g, 10g, 5g, 250mg, 500mg, 1000mg, 2000mg.
2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl-methylamino]acetic acid (CAS 154024-76-7) is a chemical compound with the molecular formula C13H21N3O4S and a molecular weight of 315.39 g/mol. IUPAC name: 2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl-methylamino]acetic acid. InChIKey: FCDUPOLHSWBTFL-AUTRQRHGSA-N.
| Molecular formula | C13H21N3O4S |
|---|---|
| Molecular weight | 315.39 g/mol |
| IUPAC name | 2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoyl-methylamino]acetic acid |
| InChIKey | FCDUPOLHSWBTFL-AUTRQRHGSA-N |
| SMILES | CN(CC(=O)O)C(=O)CCCC[C@H]1[C@@H]2[C@H](CS1)NC(=O)N2 |
Computed by PubChem (NCBI)