cas: 53749-89-6 — see every product listed under this CAS number, including other names
Bis(2,2,2-trifluoroethyl) sulfite 95% (CAS 53749-89-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A851137-100mg |
| cas | 53749-89-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 409.31 Pln | |
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 1377.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A851137 |
Bis(2,2,2-trifluoroethyl) sulfite (CAS 53749-89-6) is a chemical compound with the molecular formula C4H4F6O3S and a molecular weight of 246.13 g/mol. IUPAC name: bis(2,2,2-trifluoroethyl) sulfite. InChIKey: HVNOLEGWKGMONA-UHFFFAOYSA-N.
| Molecular formula | C4H4F6O3S |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | bis(2,2,2-trifluoroethyl) sulfite |
| InChIKey | HVNOLEGWKGMONA-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)OS(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)