cas: 53749-89-6 — see every product listed under this CAS number, including other names
Bis(2,2,2-trifluoroethyl) sulfite, 95%, 95% (CAS 53749-89-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12B9DD-100mg |
| cas | 53749-89-6 |
| size | 100mg |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 352.40 Pln | |
| Chemat | 250mg | 554.00 Pln | |
| Chemat | 1g | 1389.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Bis(2,2,2-trifluoroethyl) sulfite (CAS 53749-89-6) is a chemical compound with the molecular formula C4H4F6O3S and a molecular weight of 246.13 g/mol. IUPAC name: bis(2,2,2-trifluoroethyl) sulfite. InChIKey: HVNOLEGWKGMONA-UHFFFAOYSA-N.
| Molecular formula | C4H4F6O3S |
|---|---|
| Molecular weight | 246.13 g/mol |
| IUPAC name | bis(2,2,2-trifluoroethyl) sulfite |
| InChIKey | HVNOLEGWKGMONA-UHFFFAOYSA-N |
| SMILES | C(C(F)(F)F)OS(=O)OCC(F)(F)F |
Computed by PubChem (NCBI)