cas: 65869-64-9 — see every product listed under this CAS number, including other names
Bis(2,5-dioxopyrrolidin-1-yl) 3,3'-oxydipropanoate, 97%, 97% (CAS 65869-64-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114O97-100mg |
| cas | 65869-64-9 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 328.40 Pln | |
| Chemat | 250mg | 462.80 Pln | |
| Chemat | 500mg | 851.60 Pln | |
| Chemat | 1g | 1101.20 Pln | |
| Chemat | 5g | 3798.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]propanoate (CAS 65869-64-9) is a chemical compound with the molecular formula C14H16N2O9 and a molecular weight of 356.28 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]propanoate. InChIKey: OWCYSDGIJAVHFQ-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O9 |
|---|---|
| Molecular weight | 356.28 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]propanoate |
| InChIKey | OWCYSDGIJAVHFQ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCC(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)