cas: 65869-64-9 — see every product listed under this CAS number, including other names
Bis-PEG1-NHS ester, 97.0% (CAS 65869-64-9) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 100 mg, 5 g, 500 mg, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-130089-1 g |
| cas | 65869-64-9 |
| size | 1 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 2279.46 Pln | |
| MedChemExpress | 100 mg | 793.38 Pln | |
| MedChemExpress | 5 g | 6570.52 Pln | |
| MedChemExpress | 500 mg | 1657.16 Pln | |
| MedChemExpress | 250 mg | 1225.27 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 97.0% |
(2,5-dioxopyrrolidin-1-yl) 3-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]propanoate (CAS 65869-64-9) is a chemical compound with the molecular formula C14H16N2O9 and a molecular weight of 356.28 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]propanoate. InChIKey: OWCYSDGIJAVHFQ-UHFFFAOYSA-N.
| Molecular formula | C14H16N2O9 |
|---|---|
| Molecular weight | 356.28 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]propanoate |
| InChIKey | OWCYSDGIJAVHFQ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCC(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)