CAS 18264-71-6 appears in our catalog under these names: 2,2'-Dinitrodiphenylamine, 95%, 2-Nitro-N-(2-nitrophenyl)benzenamine, 95-<97%, 2,2'-Dinitrodiphenylamine, >95% (HPLC), Bis(2-nitrophenyl)amine, Concentration: 100 µg/ml Solvent: Acetonitrile. Offered by: Combi-blocks, Hoffman Fine Chemicals, TRC, HPC Standards. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 200g.
2-nitro-N-(2-nitrophenyl)aniline (CAS 18264-71-6) is a chemical compound with the molecular formula C12H9N3O4 and a molecular weight of 259.22 g/mol. IUPAC name: 2-nitro-N-(2-nitrophenyl)aniline. InChIKey: RENCFAVKFWOLJJ-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O4 |
|---|---|
| Molecular weight | 259.22 g/mol |
| IUPAC name | 2-nitro-N-(2-nitrophenyl)aniline |
| InChIKey | RENCFAVKFWOLJJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)NC2=CC=CC=C2[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)