CAS 843-33-4 appears in our catalog under these names: 4-(4-Nitrophenylazo)catechol, 95%, 4-(4-Nitrophenylazo)catechol/ 98%. Offered by: Combi-blocks, Chemat. Available pack sizes: 1g, 5g, 250g, 50g.
4-[(4-nitrophenyl)diazenyl]benzene-1,2-diol (CAS 843-33-4) is a chemical compound with the molecular formula C12H9N3O4 and a molecular weight of 259.22 g/mol. IUPAC name: 4-[(4-nitrophenyl)diazenyl]benzene-1,2-diol. InChIKey: DGOZWUSVOBKXNR-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O4 |
|---|---|
| Molecular weight | 259.22 g/mol |
| IUPAC name | 4-[(4-nitrophenyl)diazenyl]benzene-1,2-diol |
| InChIKey | DGOZWUSVOBKXNR-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N=NC2=CC(=C(C=C2)O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)