Bis(3-bromophenyl)methanone, 97%
cas: 25032-74-0 — see every product listed under this CAS number, including other names
Bis(3-bromophenyl)methanone, 97% (CAS 25032-74-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A509503-250mg |
| cas | 25032-74-0 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 487.19 Pln | |
| Ambeed | 1g | 1015.62 Pln | |
| Ambeed | 5g | 3118.25 Pln | |
| Chemat | 100mg | 256.40 Pln | |
| Chemat | 250mg | 314.00 Pln | |
| Chemat | 1g | 890.00 Pln | |
| Chemat | 5g | 2454.80 Pln | |
| BLDpharm | 100mg | 347.68 Pln | |
| BLDpharm | 250mg | 519.84 Pln | |
| BLDpharm | 1g | 1091.86 Pln | |
| BLDpharm | 5g | 3357.73 Pln | |
| Fluorochem | 100mg | 331.15 Pln | |
| Fluorochem | 250mg | 497.76 Pln | |
| Fluorochem | 1g | 1049.65 Pln | |
| Fluorochem | 5g | 3199.93 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
Bis(3-bromophenyl)methanone (CAS 25032-74-0) is a chemical compound with the molecular formula C13H8Br2O and a molecular weight of 340.01 g/mol. IUPAC name: bis(3-bromophenyl)methanone. InChIKey: QBNTVYGGZGPJDZ-UHFFFAOYSA-N.
| Molecular formula | C13H8Br2O |
|---|---|
| Molecular weight | 340.01 g/mol |
| IUPAC name | bis(3-bromophenyl)methanone |
| InChIKey | QBNTVYGGZGPJDZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Br)C(=O)C2=CC(=CC=C2)Br |
Computed by PubChem (NCBI)