CAS 78281-59-1 is the registry number for 2,4'-Dibromobenzophenone, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 1g, 500mg.
(2-bromophenyl)-(4-bromophenyl)methanone (CAS 78281-59-1) is a chemical compound with the molecular formula C13H8Br2O and a molecular weight of 340.01 g/mol. IUPAC name: (2-bromophenyl)-(4-bromophenyl)methanone. InChIKey: UVBUYAPAJGPEMU-UHFFFAOYSA-N.
| Molecular formula | C13H8Br2O |
|---|---|
| Molecular weight | 340.01 g/mol |
| IUPAC name | (2-bromophenyl)-(4-bromophenyl)methanone |
| InChIKey | UVBUYAPAJGPEMU-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(=O)C2=CC=C(C=C2)Br)Br |
Computed by PubChem (NCBI)