Bis(4-(trifluoromethyl)phenyl)methanone, 95%
cas: 21221-91-0 — see every product listed under this CAS number, including other names
Bis(4-(trifluoromethyl)phenyl)methanone, 95% (CAS 21221-91-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A640029-100mg |
| cas | 21221-91-0 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 398.19 Pln | |
| Ambeed | 250mg | 631.81 Pln | |
| Ambeed | 1g | 1610.81 Pln | |
| Ambeed | 5g | 4720.25 Pln | |
| BLDpharm | 100mg | 425.43 Pln | |
| BLDpharm | 250mg | 675.34 Pln | |
| BLDpharm | 1g | 1730.53 Pln | |
| BLDpharm | 5g | 5084.90 Pln | |
| Chemat | 100mg | 390.80 Pln | |
| Chemat | 250mg | 626.00 Pln | |
| Chemat | 1g | 1614.80 Pln | |
| Chemat | 5g | 4749.20 Pln | |
| Fluorochem | 250mg | 1148.57 Pln | |
| Fluorochem | 1g | 3007.29 Pln | |
| Fluorochem | 5g | 8651.14 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Bis[4-(trifluoromethyl)phenyl]methanone (CAS 21221-91-0) is a chemical compound with the molecular formula C15H8F6O and a molecular weight of 318.21 g/mol. IUPAC name: bis[4-(trifluoromethyl)phenyl]methanone. InChIKey: YHKDMJOYMRUGBQ-UHFFFAOYSA-N.
| Molecular formula | C15H8F6O |
|---|---|
| Molecular weight | 318.21 g/mol |
| IUPAC name | bis[4-(trifluoromethyl)phenyl]methanone |
| InChIKey | YHKDMJOYMRUGBQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=CC=C(C=C2)C(F)(F)F)C(F)(F)F |
Computed by PubChem (NCBI)