CAS 21084-22-0 is the registry number for 3,4'-Bis(trifluoromethyl)benzophenone, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 1g.
[3-(trifluoromethyl)phenyl]-[4-(trifluoromethyl)phenyl]methanone (CAS 21084-22-0) is a chemical compound with the molecular formula C15H8F6O and a molecular weight of 318.21 g/mol. IUPAC name: [3-(trifluoromethyl)phenyl]-[4-(trifluoromethyl)phenyl]methanone. InChIKey: HWBXNAPXNCBCQO-UHFFFAOYSA-N.
| Molecular formula | C15H8F6O |
|---|---|
| Molecular weight | 318.21 g/mol |
| IUPAC name | [3-(trifluoromethyl)phenyl]-[4-(trifluoromethyl)phenyl]methanone |
| InChIKey | HWBXNAPXNCBCQO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)C(=O)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)