cas: 1821-27-8 — see every product listed under this CAS number, including other names
Bis(4-nitrophenyl)amine 96% (CAS 1821-27-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A229887-100mg |
| cas | 1821-27-8 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 142.31 Pln | |
| Ambeed | 250mg | 170.12 Pln | |
| Ambeed | 1g | 192.38 Pln | |
| Ambeed | 5g | 320.31 Pln | |
| Ambeed | 10g | 565.06 Pln | |
| Ambeed | 25g | 1071.25 Pln | |
| Ambeed | 100g | 3274.00 Pln |
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A229887 |
4-nitro-N-(4-nitrophenyl)aniline (CAS 1821-27-8) is a chemical compound with the molecular formula C12H9N3O4 and a molecular weight of 259.22 g/mol. IUPAC name: 4-nitro-N-(4-nitrophenyl)aniline. InChIKey: MTWHRQTUBOTQTE-UHFFFAOYSA-N.
| Molecular formula | C12H9N3O4 |
|---|---|
| Molecular weight | 259.22 g/mol |
| IUPAC name | 4-nitro-N-(4-nitrophenyl)aniline |
| InChIKey | MTWHRQTUBOTQTE-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1NC2=CC=C(C=C2)[N+](=O)[O-])[N+](=O)[O-] |
Computed by PubChem (NCBI)