cas: 61358-25-6 — see every product listed under this CAS number, including other names
Bis(4-tert-Butylphenyl) iodoniumhexafluorophosphate (CAS 61358-25-6) is a chemical reagent available from Chemat. Available pack sizes: 100g, 10g, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | CM76610W-100g |
| cas | 61358-25-6 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100g | 8736.24 Pln | |
| Chemat | 10g | 1310.44 Pln | |
| Chemat | 1g | 649.56 Pln |
| delivery time | 1-2 weeks |
|---|---|
| purity | no data |
| category | Chemicals |
Bis(4-tert-butylphenyl)iodanium hexafluorophosphate (CAS 61358-25-6) is a chemical compound with the molecular formula C20H26F6IP and a molecular weight of 538.3 g/mol. IUPAC name: bis(4-tert-butylphenyl)iodanium hexafluorophosphate. InChIKey: CJLLNCQWBHTSCB-UHFFFAOYSA-N.
| Molecular formula | C20H26F6IP |
|---|---|
| Molecular weight | 538.3 g/mol |
| IUPAC name | bis(4-tert-butylphenyl)iodanium hexafluorophosphate |
| InChIKey | CJLLNCQWBHTSCB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)[I+]C2=CC=C(C=C2)C(C)(C)C.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)