CAS 61358-25-6 appears in our catalog under these names: Bis(4-tert-butylphenyl)iodonium hexafluorophosphate, 98%, Bis(4–tert–Butylphenyl) iodonium hexafluorophosphate, Bis(4-tert-Butylphenyl) iodoniumhexafluorophosphate, Bis(4-tert-butylphenyl)iodonium hexafluorophosphate, Bis(4-tert-butylphenyl)iodonium Hexafluorophosphate, >98.0%(HPLC)(T). Offered by: Combi-blocks, GLPBio, Chemat, Biosynth, TCI. Available pack sizes: 5g, 250mg, 1g, 100g, 10g, 0,025kg, 25g.
Bis(4-tert-butylphenyl)iodanium hexafluorophosphate (CAS 61358-25-6) is a chemical compound with the molecular formula C20H26F6IP and a molecular weight of 538.3 g/mol. IUPAC name: bis(4-tert-butylphenyl)iodanium hexafluorophosphate. InChIKey: CJLLNCQWBHTSCB-UHFFFAOYSA-N.
| Molecular formula | C20H26F6IP |
|---|---|
| Molecular weight | 538.3 g/mol |
| IUPAC name | bis(4-tert-butylphenyl)iodanium hexafluorophosphate |
| InChIKey | CJLLNCQWBHTSCB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC=C(C=C1)[I+]C2=CC=C(C=C2)C(C)(C)C.F[P-](F)(F)(F)(F)F |
Computed by PubChem (NCBI)