cas: 32005-36-0 — see every product listed under this CAS number, including other names
Bis(dibenzylideneacetone)palladium, 98%, 98% (CAS 32005-36-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1145J3-250mg |
| cas | 32005-36-0 |
| size | 250mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 170.00 Pln | |
| Chemat | 5g | 592.40 Pln | |
| Chemat | 10g | 1110.80 Pln | |
| Chemat | 25g | 2685.20 Pln | |
| Chemat | 50g | 4816.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium (CAS 32005-36-0) is a chemical compound with the molecular formula C34H28O2Pd and a molecular weight of 575.0 g/mol. IUPAC name: bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium. InChIKey: UKSZBOKPHAQOMP-SVLSSHOZSA-N.
| Molecular formula | C34H28O2Pd |
|---|---|
| Molecular weight | 575.0 g/mol |
| IUPAC name | bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium |
| InChIKey | UKSZBOKPHAQOMP-SVLSSHOZSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)/C=C/C2=CC=CC=C2.C1=CC=C(C=C1)/C=C/C(=O)/C=C/C2=CC=CC=C2.[Pd] |
Computed by PubChem (NCBI)