CAS 190385-99-0 is the registry number for (1E,4E)-Bis(dibenzylideneacetone)palladium, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium (CAS 190385-99-0) is a chemical compound with the molecular formula C34H28O2Pd and a molecular weight of 575.0 g/mol. IUPAC name: bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium. InChIKey: UKSZBOKPHAQOMP-SVLSSHOZSA-N.
| Molecular formula | C34H28O2Pd |
|---|---|
| Molecular weight | 575.0 g/mol |
| IUPAC name | bis((1E,4E)-1,5-diphenylpenta-1,4-dien-3-one);palladium |
| InChIKey | UKSZBOKPHAQOMP-SVLSSHOZSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)/C=C/C2=CC=CC=C2.C1=CC=C(C=C1)/C=C/C(=O)/C=C/C2=CC=CC=C2.[Pd] |
Computed by PubChem (NCBI)