cas: 1807539-02-1 — see every product listed under this CAS number, including other names
Bis-PEG1-PFP ester 95% (CAS 1807539-02-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A750143-100mg |
| cas | 1807539-02-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 565.06 Pln | |
| Ambeed | 250mg | 1065.69 Pln | |
| Ambeed | 1g | 2689.94 Pln | |
| Ambeed | 5g | 12368.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A750143 |
(2,3,4,5,6-pentafluorophenyl) 3-[3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propoxy]propanoate (CAS 1807539-02-1) is a chemical compound with the molecular formula C18H8F10O5 and a molecular weight of 494.2 g/mol. IUPAC name: (2,3,4,5,6-pentafluorophenyl) 3-[3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propoxy]propanoate. InChIKey: PACGANKFUNUYHE-UHFFFAOYSA-N.
| Molecular formula | C18H8F10O5 |
|---|---|
| Molecular weight | 494.2 g/mol |
| IUPAC name | (2,3,4,5,6-pentafluorophenyl) 3-[3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propoxy]propanoate |
| InChIKey | PACGANKFUNUYHE-UHFFFAOYSA-N |
| SMILES | C(COCCC(=O)OC1=C(C(=C(C(=C1F)F)F)F)F)C(=O)OC2=C(C(=C(C(=C2F)F)F)F)F |
Computed by PubChem (NCBI)