Bis-PEG5-NHS ester, 99.83%
cas: 756526-03-1 — see every product listed under this CAS number, including other names
Bis-PEG5-NHS ester, 99.83% (CAS 756526-03-1) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 500 mg, 1 g, 100 mg, 10 g, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-126889-5 g |
| cas | 756526-03-1 |
| size | 5 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 2209.80 Pln | |
| MedChemExpress | 500 mg | 649.42 Pln | |
| MedChemExpress | 1 g | 937.34 Pln | |
| MedChemExpress | 100 mg | 287.18 Pln | |
| MedChemExpress | 10 g | 3263.99 Pln | |
| MedChemExpress | 250 mg | 454.37 Pln |
properties
| delivery time | 1-2 weeks |
|---|---|
| purity | 99.83% |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 756526-03-1) is a chemical compound with the molecular formula C22H32N2O13 and a molecular weight of 532.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: FTYUGLBWKRXQBD-UHFFFAOYSA-N.
| Molecular formula | C22H32N2O13 |
|---|---|
| Molecular weight | 532.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | FTYUGLBWKRXQBD-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCOCCC(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)
Synonyms:
Bis-PEG5-NHS ester, Bis(NHS)PEG5, bis(2,5-dioxopyrrolidin-1-yl) 4,7,10,13,16-pentaoxanonadecane-1,19-dioate, Bis-dPEG(R)5-NHS ester, bis(2,5-dioxopyrrolidin-1-yl) 4,7,10,13,16-pentaoxanonadecanedioate, Bis-PEG5-NHS, 4-Biotin, orb1909495, Bis(3-PEG4)propionic acid N-hydroxysuccinimide diester, Di(N-succinimidyl) 4,7,10,13,16-Pentaoxanonadecanedioate