cas: 756526-03-1 — see every product listed under this CAS number, including other names
bis(2,5-dioxopyrrolidin-1-yl) 4,7,10,13,16-pentaoxanonadecane-1,19-dioate, 97%, 97% (CAS 756526-03-1) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 10g, 25mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G65E-500mg |
| cas | 756526-03-1 |
| size | 500mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 500mg | 304.40 Pln | |
| Chemat | 10g | 2661.20 Pln | |
| Chemat | 25mg | 93.20 Pln | |
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 184.40 Pln | |
| Chemat | 1g | 458.00 Pln | |
| Chemat | 5g | 1360.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 756526-03-1) is a chemical compound with the molecular formula C22H32N2O13 and a molecular weight of 532.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: FTYUGLBWKRXQBD-UHFFFAOYSA-N.
| Molecular formula | C22H32N2O13 |
|---|---|
| Molecular weight | 532.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | FTYUGLBWKRXQBD-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCOCCC(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)