cas: 119189-70-7 — see every product listed under this CAS number, including other names
Bis-PEG6-acid 95% (CAS 119189-70-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A661672-100mg |
| cas | 119189-70-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 203.50 Pln | |
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 731.94 Pln | |
| Ambeed | 5g | 2400.69 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A661672 |
3-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 119189-70-7) is a chemical compound with the molecular formula C16H30O10 and a molecular weight of 382.40 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: YFBGEYNLLRKUTP-UHFFFAOYSA-N.
| Molecular formula | C16H30O10 |
|---|---|
| Molecular weight | 382.40 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | YFBGEYNLLRKUTP-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)