Bis-PEG9-acid, 97%, 97%
cas: 1268488-70-5 — see every product listed under this CAS number, including other names
Bis-PEG9-acid, 97%, 97% (CAS 1268488-70-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110IT6-100mg |
| cas | 1268488-70-5 |
| size | 100mg |
| availability | 5g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 222.80 Pln | |
| Chemat | 1g | 477.20 Pln | |
| Chemat | 5g | 1979.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1268488-70-5) is a chemical compound with the molecular formula C22H42O13 and a molecular weight of 514.6 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: MZPXCHJGEDEJHQ-UHFFFAOYSA-N.
| Molecular formula | C22H42O13 |
|---|---|
| Molecular weight | 514.6 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | MZPXCHJGEDEJHQ-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)