CAS 1268488-70-5 appears in our catalog under these names: Bis-PEG17-acid, 95%, Bis-PEG9-acid, 97%, Bis-PEG25-acid, 95%, Bis-PEG21-acid, 95%, Bis-PEG9-acid. Offered by: Combi-blocks, TRC, GLPBio, Biosynth, Chemat. Available pack sizes: 250mg, 100mg, 1g, 500mg, 5g, 1000mg, 5000mg, 1 g.
3-[2-[2-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1268488-70-5) is a chemical compound with the molecular formula C22H42O13 and a molecular weight of 514.6 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: MZPXCHJGEDEJHQ-UHFFFAOYSA-N.
| Molecular formula | C22H42O13 |
|---|---|
| Molecular weight | 514.6 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | MZPXCHJGEDEJHQ-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)