cas: 69981-39-1 — see every product listed under this CAS number, including other names
Bis-Tos-(2-hydroxyethyl disulfide) 95% (CAS 69981-39-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A755860-100mg |
| cas | 69981-39-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 515.00 Pln | |
| Ambeed | 250mg | 854.31 Pln | |
| Ambeed | 1g | 2217.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A755860 |
2-[2-(4-methylphenyl)sulfonyloxyethyldisulfanyl]ethyl 4-methylbenzenesulfonate (CAS 69981-39-1) is a chemical compound with the molecular formula C18H22O6S4 and a molecular weight of 462.6 g/mol. IUPAC name: 2-[2-(4-methylphenyl)sulfonyloxyethyldisulfanyl]ethyl 4-methylbenzenesulfonate. InChIKey: BBGVCMPJFAYXLJ-UHFFFAOYSA-N.
| Molecular formula | C18H22O6S4 |
|---|---|
| Molecular weight | 462.6 g/mol |
| IUPAC name | 2-[2-(4-methylphenyl)sulfonyloxyethyldisulfanyl]ethyl 4-methylbenzenesulfonate |
| InChIKey | BBGVCMPJFAYXLJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCSSCCOS(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)