cas: 69981-39-1 — see every product listed under this CAS number, including other names
Bis-Tos-(2-hydroxyethyl disulfide), 95%, 95% (CAS 69981-39-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IBZY-100mg |
| cas | 69981-39-1 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 395.60 Pln | |
| Chemat | 250mg | 770.00 Pln | |
| Chemat | 1g | 1778.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
2-[2-(4-methylphenyl)sulfonyloxyethyldisulfanyl]ethyl 4-methylbenzenesulfonate (CAS 69981-39-1) is a chemical compound with the molecular formula C18H22O6S4 and a molecular weight of 462.6 g/mol. IUPAC name: 2-[2-(4-methylphenyl)sulfonyloxyethyldisulfanyl]ethyl 4-methylbenzenesulfonate. InChIKey: BBGVCMPJFAYXLJ-UHFFFAOYSA-N.
| Molecular formula | C18H22O6S4 |
|---|---|
| Molecular weight | 462.6 g/mol |
| IUPAC name | 2-[2-(4-methylphenyl)sulfonyloxyethyldisulfanyl]ethyl 4-methylbenzenesulfonate |
| InChIKey | BBGVCMPJFAYXLJ-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCSSCCOS(=O)(=O)C2=CC=C(C=C2)C |
Computed by PubChem (NCBI)