CAS 176504-36-2 appears in our catalog under these names: Bisindolylmaleimide I hydrochloride, 98%, Bisindolylmaleimide I (hydrochloride), GF 109203X hydrochloride, BISINDOLYLMALEIMIDE I HYDROCHLORIDE, Bisindolylmaleimide I, Hydro 1PC X 1MG. Offered by: AmBeed, GLPBio, Chemat, Sigma-Aldrich, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 250UG, 25mg, 50mg, 100mg, 200mg.
3-[1-[3-(dimethylamino)propyl]indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione;hydrochloride (CAS 176504-36-2) is a chemical compound with the molecular formula C25H25ClN4O2 and a molecular weight of 448.9 g/mol. IUPAC name: 3-[1-[3-(dimethylamino)propyl]indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione;hydrochloride. InChIKey: XRAMWNCMYJHGGH-UHFFFAOYSA-N.
| Molecular formula | C25H25ClN4O2 |
|---|---|
| Molecular weight | 448.9 g/mol |
| IUPAC name | 3-[1-[3-(dimethylamino)propyl]indol-3-yl]-4-(1H-indol-3-yl)pyrrole-2,5-dione;hydrochloride |
| InChIKey | XRAMWNCMYJHGGH-UHFFFAOYSA-N |
| SMILES | CN(C)CCCN1C=C(C2=CC=CC=C21)C3=C(C(=O)NC3=O)C4=CNC5=CC=CC=C54.Cl |
Computed by PubChem (NCBI)