cas: 119139-23-0 — see every product listed under this CAS number, including other names
Bisindolylmaleimide IV (CAS 119139-23-0) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 10mg, 100mg, 25mg, 5mg, 10mM (in 1ml dmso), 50mg. Offered by: GLPBio, Chemat.
| brand | GLPBio |
|---|---|
| catalog number | GC14716-1 |
| cas | 119139-23-0 |
| size | 1mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1mg | 508.11 Pln | |
| GLPBio | 10mg | 779.58 Pln | |
| GLPBio | 100mg | 1856.09 Pln | |
| GLPBio | 25mg | 1154.02 Pln | |
| GLPBio | 5mg | 643.84 Pln | |
| GLPBio | 10mM (in 1ml dmso) | 667.25 Pln | |
| GLPBio | 50mg | 1448.89 Pln | |
| Chemat | 1mg | 629.62 Pln | |
| Chemat | 5mg | 1348.60 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
3,4-bis(1H-indol-3-yl)pyrrole-2,5-dione is a member of indoles and a member of maleimides.
Source: ChEBI
| Molecular formula | C20H13N3O2 |
|---|---|
| Molecular weight | 327.3 g/mol |
| IUPAC name | 3,4-bis(1H-indol-3-yl)pyrrole-2,5-dione |
| InChIKey | DQYBRTASHMYDJG-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C3=C(C(=O)NC3=O)C4=CNC5=CC=CC=C54 |
Computed by PubChem (NCBI)