CAS 7466-45-7 is the registry number for 2,3-Diphenyl-6-nitroquinoxaline, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
6-nitro-2,3-diphenylquinoxaline (CAS 7466-45-7) is a chemical compound with the molecular formula C20H13N3O2 and a molecular weight of 327.3 g/mol. IUPAC name: 6-nitro-2,3-diphenylquinoxaline. InChIKey: QSJFEWWENJXUCR-UHFFFAOYSA-N.
| Molecular formula | C20H13N3O2 |
|---|---|
| Molecular weight | 327.3 g/mol |
| IUPAC name | 6-nitro-2,3-diphenylquinoxaline |
| InChIKey | QSJFEWWENJXUCR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(C=C(C=C3)[N+](=O)[O-])N=C2C4=CC=CC=C4 |
Computed by PubChem (NCBI)