CAS 201593-84-2 appears in our catalog under these names: Bistrifluron, Bistrifluron, >95% (HPLC), Bistrifluron 100 µg/mL in Acetonitrile, N-{(2-Chloro-3,5-Bis(Trifluoromethyl)Phenyl)Carbamoyl}-2,6-Difluorobenzamide, Bistrifluron, 99.38%. Offered by: Chemat Brand, TRC, Dr. Ehrenstorfer, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 250mg, 25mg, 10mg, 1ml, 5mg, 50mg.
N-[[2-chloro-3,5-bis(trifluoromethyl)phenyl]carbamoyl]-2,6-difluorobenzamide (CAS 201593-84-2) is a chemical compound with the molecular formula C16H7ClF8N2O2 and a molecular weight of 446.68 g/mol. IUPAC name: N-[[2-chloro-3,5-bis(trifluoromethyl)phenyl]carbamoyl]-2,6-difluorobenzamide. InChIKey: YNKFZRGTXAPYFD-UHFFFAOYSA-N.
| Molecular formula | C16H7ClF8N2O2 |
|---|---|
| Molecular weight | 446.68 g/mol |
| IUPAC name | N-[[2-chloro-3,5-bis(trifluoromethyl)phenyl]carbamoyl]-2,6-difluorobenzamide |
| InChIKey | YNKFZRGTXAPYFD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)NC(=O)NC2=CC(=CC(=C2Cl)C(F)(F)F)C(F)(F)F)F |
Computed by PubChem (NCBI)