Products 2280037-51-4
CAS 2280037-51-4 appears in our catalog under these names: Bobcat339, Bobcat 339, BOBCAT339, 98%, 98%, Bobcat339, 99.44%, 1-([1,1'-Biphenyl]-3-yl)-4-amino-5-chloropyrimidin-2(1H)-one, 98%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress, Fluorochem. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 1mg, 250mg, 25 mg.
4-amino-5-chloro-1-(3-phenylphenyl)pyrimidin-2-one (CAS 2280037-51-4) is a chemical compound with the molecular formula C16H12ClN3O and a molecular weight of 297.74 g/mol. IUPAC name: 4-amino-5-chloro-1-(3-phenylphenyl)pyrimidin-2-one. InChIKey: QMGYGOOYCNTEQO-UHFFFAOYSA-N.
| Molecular formula | C16H12ClN3O |
|---|---|
| Molecular weight | 297.74 g/mol |
| IUPAC name | 4-amino-5-chloro-1-(3-phenylphenyl)pyrimidin-2-one |
| InChIKey | QMGYGOOYCNTEQO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)N3C=C(C(=NC3=O)N)Cl |
Computed by PubChem (NCBI)