Products 854867-67-7
CAS 854867-67-7 is the registry number for 8-Chloro-2-phenylquinoline-4-carbohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
8-chloro-2-phenylquinoline-4-carbohydrazide (CAS 854867-67-7) is a chemical compound with the molecular formula C16H12ClN3O and a molecular weight of 297.74 g/mol. IUPAC name: 8-chloro-2-phenylquinoline-4-carbohydrazide. InChIKey: IZYYHUJEYPLOKT-UHFFFAOYSA-N.
| Molecular formula | C16H12ClN3O |
|---|---|
| Molecular weight | 297.74 g/mol |
| IUPAC name | 8-chloro-2-phenylquinoline-4-carbohydrazide |
| InChIKey | IZYYHUJEYPLOKT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NC3=C(C=CC=C3Cl)C(=C2)C(=O)NN |
Computed by PubChem (NCBI)