cas: 959581-21-6 — see every product listed under this CAS number, including other names
Boc-(R)-gamma-(4-methyl-benzyl)-L-proline, 98%, 98% (CAS 959581-21-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IJN9-100mg |
| cas | 959581-21-6 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 453.20 Pln | |
| Chemat | 250mg | 722.00 Pln | |
| Chemat | 1g | 2214.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S,4R)-4-[(4-methylphenyl)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 959581-21-6) is a chemical compound with the molecular formula C18H25NO4 and a molecular weight of 319.4 g/mol. IUPAC name: (2S,4R)-4-[(4-methylphenyl)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: OMVHMNVKZQEBAU-CABCVRRESA-N.
| Molecular formula | C18H25NO4 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | (2S,4R)-4-[(4-methylphenyl)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | OMVHMNVKZQEBAU-CABCVRRESA-N |
| SMILES | CC1=CC=C(C=C1)C[C@@H]2C[C@H](N(C2)C(=O)OC(C)(C)C)C(=O)O |
Computed by PubChem (NCBI)