cas: 959583-52-9 — see every product listed under this CAS number, including other names
Boc-(r)-gamma-(4-fluoro-benzyl)-l-proline, ≥95%, ≥95% (CAS 959583-52-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IJNX-50mg |
| cas | 959583-52-9 |
| size | 50mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 611.60 Pln | |
| Chemat | 100mg | 1144.40 Pln | |
| Chemat | 250mg | 1835.60 Pln | |
| Chemat | 1g | 2771.60 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
(2S,4R)-4-[(4-fluorophenyl)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 959583-52-9) is a chemical compound with the molecular formula C17H22FNO4 and a molecular weight of 323.4 g/mol. IUPAC name: (2S,4R)-4-[(4-fluorophenyl)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: FGLYPQZHYLRBOI-OCCSQVGLSA-N.
| Molecular formula | C17H22FNO4 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | (2S,4R)-4-[(4-fluorophenyl)methyl]-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | FGLYPQZHYLRBOI-OCCSQVGLSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@H]1C(=O)O)CC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)