Products 1820574-66-0
CAS 1820574-66-0 is the registry number for 1-tert-butyl 3-methyl (3r,4s)-4-(4-fluorophenyl)pyrrolidine-1,3-dicarboxylate, rac, trans, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
1-O-tert-butyl 3-O-methyl (3R,4S)-4-(4-fluorophenyl)pyrrolidine-1,3-dicarboxylate (CAS 1820574-66-0) is a chemical compound with the molecular formula C17H22FNO4 and a molecular weight of 323.4 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl (3R,4S)-4-(4-fluorophenyl)pyrrolidine-1,3-dicarboxylate. InChIKey: JTPXLVZJCBDFHB-KGLIPLIRSA-N.
| Molecular formula | C17H22FNO4 |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl (3R,4S)-4-(4-fluorophenyl)pyrrolidine-1,3-dicarboxylate |
| InChIKey | JTPXLVZJCBDFHB-KGLIPLIRSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@H](C1)C(=O)OC)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)