cas: 203866-17-5 — see every product listed under this CAS number, including other names
Boc-4,4-DiF-Pro-OH 97% (CAS 203866-17-5) is a chemical reagent available from Chemat. Available pack sizes: 500g, 100mg, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A131602-500g |
| cas | 203866-17-5 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 10605.38 Pln | |
| Ambeed | 100mg | 142.31 Pln | |
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 181.25 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 10g | 414.88 Pln | |
| Ambeed | 25g | 893.25 Pln | |
| Ambeed | 100g | 2706.62 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A131602 |
1-O-tert-butyl 2-O-methyl (2S)-4,4-difluoropyrrolidine-1,2-dicarboxylate (CAS 203866-17-5) is a chemical compound with the molecular formula C11H17F2NO4 and a molecular weight of 265.25 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2S)-4,4-difluoropyrrolidine-1,2-dicarboxylate. InChIKey: RQDZKOOUQIDZOG-ZETCQYMHSA-N.
| Molecular formula | C11H17F2NO4 |
|---|---|
| Molecular weight | 265.25 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2S)-4,4-difluoropyrrolidine-1,2-dicarboxylate |
| InChIKey | RQDZKOOUQIDZOG-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C[C@H]1C(=O)OC)(F)F |
Computed by PubChem (NCBI)