CAS 647857-74-7 appears in our catalog under these names: (R)-1-tert-Butyl 2-methyl 4,4-difluoropyrrolidine-1,2-dicarboxylate, 95%, 1–tert–Butyl 2–methyl (2R)–4,4–difluoropyrrolidine–1,2–dicarboxylate, (R)-1-tert-Butyl 2-methyl 4,4-difluoropyrrolidine-1,2-dicarboxylate 98%, (R)-1-TERT-BUTYL 2-METHYL 4，4-DIFLUOROPYRROLIDINE-1，2-DICARBOXYLATE, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 10g, 250mg, 25g, 50g, 100g.
1-O-tert-butyl 2-O-methyl (2R)-4,4-difluoropyrrolidine-1,2-dicarboxylate (CAS 647857-74-7) is a chemical compound with the molecular formula C11H17F2NO4 and a molecular weight of 265.25 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R)-4,4-difluoropyrrolidine-1,2-dicarboxylate. InChIKey: RQDZKOOUQIDZOG-SSDOTTSWSA-N.
| Molecular formula | C11H17F2NO4 |
|---|---|
| Molecular weight | 265.25 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R)-4,4-difluoropyrrolidine-1,2-dicarboxylate |
| InChIKey | RQDZKOOUQIDZOG-SSDOTTSWSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C[C@@H]1C(=O)OC)(F)F |
Computed by PubChem (NCBI)