cas: 3392-05-0 — see every product listed under this CAS number, including other names
Boc-Ala-OSu, 95% (CAS 3392-05-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 50g. Offered by: Fluorochem, Ambeed, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | M03255-1G |
| cas | 3392-05-0 |
| size | 1g |
| availability | In Stock UK |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 102.07 Pln | |
| Fluorochem | 5g | 112.48 Pln | |
| Fluorochem | 10g | 164.54 Pln | |
| Fluorochem | 25g | 263.47 Pln | |
| Fluorochem | 100g | 794.53 Pln | |
| Fluorochem | 500g | 3387.37 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 25g | 309.19 Pln | |
| Ambeed | 100g | 776.44 Pln | |
| Ambeed | 500g | 3585.50 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 83.60 Pln | |
| Chemat | 10g | 107.60 Pln | |
| Chemat | 25g | 165.20 Pln | |
| Chemat | 50g | 266.00 Pln | |
| Chemat | 100g | 472.40 Pln |
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 1-2 weeks |
| category | Odczynniki chemiczne |
(2,5-dioxopyrrolidin-1-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 3392-05-0) is a chemical compound with the molecular formula C12H18N2O6 and a molecular weight of 286.28 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: COMUWNFVTWKSDT-UHFFFAOYSA-N.
| Molecular formula | C12H18N2O6 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | COMUWNFVTWKSDT-UHFFFAOYSA-N |
| SMILES | CC(C(=O)ON1C(=O)CCC1=O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)