Products 220230-77-3
CAS 220230-77-3 is the registry number for Glucose Impurity 6. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,2S,3R)-1-[5-[(E,3S)-3,4-dihydroxybut-1-enyl]pyrazin-2-yl]butane-1,2,3,4-tetrol (CAS 220230-77-3) is a chemical compound with the molecular formula C12H18N2O6 and a molecular weight of 286.28 g/mol. IUPAC name: (1R,2S,3R)-1-[5-[(E,3S)-3,4-dihydroxybut-1-enyl]pyrazin-2-yl]butane-1,2,3,4-tetrol. InChIKey: KBYJJZRCLYIHDO-BUIZIDAXSA-N.
| Molecular formula | C12H18N2O6 |
|---|---|
| Molecular weight | 286.28 g/mol |
| IUPAC name | (1R,2S,3R)-1-[5-[(E,3S)-3,4-dihydroxybut-1-enyl]pyrazin-2-yl]butane-1,2,3,4-tetrol |
| InChIKey | KBYJJZRCLYIHDO-BUIZIDAXSA-N |
| SMILES | C1=C(N=CC(=N1)[C@H]([C@@H]([C@@H](CO)O)O)O)/C=C/[C@@H](CO)O |
Computed by PubChem (NCBI)